About 3-methyl-5-prop-2-ynyl-1,2-thiazole
3-methyl-5-prop-2-ynyl-1,2-thiazole (PubChem CID 57201114) has the molecular formula C7H7NS
and a molecular weight of 137.21 g/mol. Its IUPAC name is 3-methyl-5-prop-2-ynyl-1,2-thiazole.
Molecular Properties
| Compound Name | 3-methyl-5-prop-2-ynyl-1,2-thiazole |
| PubChem CID | 57201114 |
| Molecular Formula | C7H7NS |
| Molecular Weight | 137.21 g/mol |
| Exact Mass | 137.03 |
| IUPAC Name | 3-methyl-5-prop-2-ynyl-1,2-thiazole |
| SMILES | C#CCc1cc(C)ns1 |
| InChI | InChI=1S/C7H7NS/c1-3-4-7-5-6(2)8-9-7/h1,5H,4H2,2H3 |
| InChIKey | VWQSPIBBZILONI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-5-prop-2-ynyl-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-prop-2-ynyl-1,2-thiazole?
The IUPAC name of 3-methyl-5-prop-2-ynyl-1,2-thiazole (CID 57201114) is 3-methyl-5-prop-2-ynyl-1,2-thiazole.
What is the SMILES notation for 3-methyl-5-prop-2-ynyl-1,2-thiazole?
The canonical SMILES for 3-methyl-5-prop-2-ynyl-1,2-thiazole is C#CCc1cc(C)ns1.
What is the InChIKey of 3-methyl-5-prop-2-ynyl-1,2-thiazole?
The InChIKey is VWQSPIBBZILONI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NS/c1-3-4-7-5-6(2)8-9-7/h1,5H,4H2,2H3.
What are the key properties of 3-methyl-5-prop-2-ynyl-1,2-thiazole?
3-methyl-5-prop-2-ynyl-1,2-thiazole has a molecular weight of 137.21 g/mol, XLogP of 1.63, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-prop-2-ynyl-1,2-thiazole is sourced from PubChem (CID 57201114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).