C12H20N2 — CID 57201163
4-N,7-N-dimethyldeca-1,9-diene-4,7-diimine (PubChem CID 57201163) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 4-N,7-N-dimethyldeca-1,9-diene-4,7-diimine.
| Compound Name | 4-N,7-N-dimethyldeca-1,9-diene-4,7-diimine |
|---|---|
| PubChem CID | 57201163 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 4-N,7-N-dimethyldeca-1,9-diene-4,7-diimine |
| SMILES | C=CC/C(CC/C(CC=C)=N/C)=N\C |
| InChI | InChI=1S/C12H20N2/c1-5-7-11(13-3)9-10-12(14-4)8-6-2/h5-6H,1-2,7-10H2,3-4H3/b13-11+,14-12+ |
| InChIKey | BJSSJKBVLDYRRF-PHEQNACWSA-N |
| XLogP | 3.06 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|