About 3,4-dimethyl-1-sulfanylidene-4,5-dihydro-1,3-thiazol-3-ium
3,4-dimethyl-1-sulfanylidene-4,5-dihydro-1,3-thiazol-3-ium (PubChem CID 57201290) has the molecular formula C5H10NS2+
and a molecular weight of 148.28 g/mol. Its IUPAC name is 3,4-dimethyl-1-sulfanylidene-4,5-dihydro-1,3-thiazol-3-ium.
Molecular Properties
| Compound Name | 3,4-dimethyl-1-sulfanylidene-4,5-dihydro-1,3-thiazol-3-ium |
| PubChem CID | 57201290 |
| Molecular Formula | C5H10NS2+ |
| Molecular Weight | 148.28 g/mol |
| Exact Mass | 148.02 |
| IUPAC Name | 3,4-dimethyl-1-sulfanylidene-4,5-dihydro-1,3-thiazol-3-ium |
| SMILES | CC1CS(=S)C=[N+]1C |
| InChI | InChI=1S/C5H10NS2/c1-5-3-8(7)4-6(5)2/h4-5H,3H2,1-2H3/q+1 |
| InChIKey | RGBMGUKSZUDUQW-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.28 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-1-sulfanylidene-4,5-dihydro-1,3-thiazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-1-sulfanylidene-4,5-dihydro-1,3-thiazol-3-ium?
The IUPAC name of 3,4-dimethyl-1-sulfanylidene-4,5-dihydro-1,3-thiazol-3-ium (CID 57201290) is 3,4-dimethyl-1-sulfanylidene-4,5-dihydro-1,3-thiazol-3-ium.
What is the SMILES notation for 3,4-dimethyl-1-sulfanylidene-4,5-dihydro-1,3-thiazol-3-ium?
The canonical SMILES for 3,4-dimethyl-1-sulfanylidene-4,5-dihydro-1,3-thiazol-3-ium is CC1CS(=S)C=[N+]1C.
What is the InChIKey of 3,4-dimethyl-1-sulfanylidene-4,5-dihydro-1,3-thiazol-3-ium?
The InChIKey is RGBMGUKSZUDUQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10NS2/c1-5-3-8(7)4-6(5)2/h4-5H,3H2,1-2H3/q+1.
What are the key properties of 3,4-dimethyl-1-sulfanylidene-4,5-dihydro-1,3-thiazol-3-ium?
3,4-dimethyl-1-sulfanylidene-4,5-dihydro-1,3-thiazol-3-ium has a molecular weight of 148.28 g/mol, XLogP of 0.14, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-1-sulfanylidene-4,5-dihydro-1,3-thiazol-3-ium is sourced from PubChem (CID 57201290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).