C27H36F3NO3 — CID 57201615
(3aS,3bS,9aR,9bR,11aR)-4,6,9a,11a-tetramethyl-2-[4-(trifluoromethoxy)phenoxy]-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one (PubChem CID 57201615) has the molecular formula C27H36F3NO3 and a molecular weight of 479.58 g/mol. Its IUPAC name is (3aS,3bS,9aR,9bR,11aR)-4,6,9a,11a-tetramethyl-2-[4-(trifluoromethoxy)phenoxy]-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one.
| Compound Name | (3aS,3bS,9aR,9bR,11aR)-4,6,9a,11a-tetramethyl-2-[4-(trifluoromethoxy)phenoxy]-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 57201615 |
| Molecular Formula | C27H36F3NO3 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | (3aS,3bS,9aR,9bR,11aR)-4,6,9a,11a-tetramethyl-2-[4-(trifluoromethoxy)phenoxy]-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one |
| SMILES | CC1CC2N(C)C(=O)CC[C@]2(C)[C@@H]2CC[C@]3(C)CC(Oc4ccc(OC(F)(F)F)cc4)C[C@H]3[C@H]12 |
| InChI | InChI=1S/C27H36F3NO3/c1-16-13-22-26(3,12-10-23(32)31(22)4)20-9-11-25(2)15-19(14-21(25)24(16)20)33-17-5-7-18(8-6-17)34-27(28,29)30/h5-8,16,19-22,24H,9-15H2,1-4H3/t16?,19?,20-,21+,22?,24-,25-,26-/m1/s1 |
| InChIKey | JSQVUYJQKCKICA-SURHNHEISA-N |
| XLogP | 6.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |