C27H31NO7 — CID 57201638
7-[[(2S,4S,5R,6R)-4-amino-5-hydroxy-6-methyloxan-2-yl]methyl]-6,11-dihydroxy-9-(2-hydroxyethyl)-7,8,9,10-tetrahydrotetracene-5,12-dione (PubChem CID 57201638) has the molecular formula C27H31NO7 and a molecular weight of 481.55 g/mol. Its IUPAC name is 7-[[(2S,4S,5R,6R)-4-amino-5-hydroxy-6-methyloxan-2-yl]methyl]-6,11-dihydroxy-9-(2-hydroxyethyl)-7,8,9,10-tetrahydrotetracene-5,12-dione.
| Compound Name | 7-[[(2S,4S,5R,6R)-4-amino-5-hydroxy-6-methyloxan-2-yl]methyl]-6,11-dihydroxy-9-(2-hydroxyethyl)-7,8,9,10-tetrahydrotetracene-5,12-dione |
|---|---|
| PubChem CID | 57201638 |
| Molecular Formula | C27H31NO7 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 7-[[(2S,4S,5R,6R)-4-amino-5-hydroxy-6-methyloxan-2-yl]methyl]-6,11-dihydroxy-9-(2-hydroxyethyl)-7,8,9,10-tetrahydrotetracene-5,12-dione |
| SMILES | C[C@H]1O[C@@H](CC2CC(CCO)Cc3c(O)c4c(c(O)c32)C(=O)c2ccccc2C4=O)C[C@H](N)[C@H]1O |
| InChI | InChI=1S/C27H31NO7/c1-12-23(30)19(28)11-15(35-12)10-14-8-13(6-7-29)9-18-20(14)27(34)22-21(26(18)33)24(31)16-4-2-3-5-17(16)25(22)32/h2-5,12-15,19,23,29-30,33-34H,6-11,28H2,1H3/t12-,13?,14?,15+,19+,23+/m1/s1 |
| InChIKey | CJTLZQCNWSSLEV-RJLIYFMVSA-N |
| XLogP | 2.16 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|