C25H35FO2 — CID 57201854
(8R,9R,10S,13R,14R)-17-(4-fluorophenyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol (PubChem CID 57201854) has the molecular formula C25H35FO2 and a molecular weight of 386.55 g/mol. Its IUPAC name is (8R,9R,10S,13R,14R)-17-(4-fluorophenyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol.
| Compound Name | (8R,9R,10S,13R,14R)-17-(4-fluorophenyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol |
|---|---|
| PubChem CID | 57201854 |
| Molecular Formula | C25H35FO2 |
| Molecular Weight | 386.55 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | (8R,9R,10S,13R,14R)-17-(4-fluorophenyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol |
| SMILES | C[C@]12CCC(O)CC1CC[C@@H]1[C@H]2CC[C@]2(C)C(c3ccc(F)cc3)CC[C@@]12O |
| InChI | InChI=1S/C25H35FO2/c1-23-12-9-19(27)15-17(23)5-8-22-21(23)10-13-24(2)20(11-14-25(22,24)28)16-3-6-18(26)7-4-16/h3-4,6-7,17,19-22,27-28H,5,8-15H2,1-2H3/t17?,19?,20?,21-,22-,23+,24-,25-/m1/s1 |
| InChIKey | QYORBNNRHYWILS-MMADVANDSA-N |
| XLogP | 5.43 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.55 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |