About [1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylindol-3-yl] butanoate
[1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylindol-3-yl] butanoate (PubChem CID 57201994) has the molecular formula C27H35NO4S
and a molecular weight of 469.65 g/mol. Its IUPAC name is [1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylindol-3-yl] butanoate.
Molecular Properties
| Compound Name | [1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylindol-3-yl] butanoate |
| PubChem CID | 57201994 |
| Molecular Formula | C27H35NO4S |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | [1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylindol-3-yl] butanoate |
| SMILES | CCCC(=O)Oc1cn(S(=O)(=O)c2c(C(C)C)cc(C(C)C)cc2C(C)C)c2ccccc12 |
| InChI | InChI=1S/C27H35NO4S/c1-8-11-26(29)32-25-16-28(24-13-10-9-12-21(24)25)33(30,31)27-22(18(4)5)14-20(17(2)3)15-23(27)19(6)7/h9-10,12-19H,8,11H2,1-7H3 |
| InChIKey | LLBSXVFKMWKVFC-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylindol-3-yl] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylindol-3-yl] butanoate?
The IUPAC name of [1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylindol-3-yl] butanoate (CID 57201994) is [1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylindol-3-yl] butanoate.
What is the SMILES notation for [1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylindol-3-yl] butanoate?
The canonical SMILES for [1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylindol-3-yl] butanoate is CCCC(=O)Oc1cn(S(=O)(=O)c2c(C(C)C)cc(C(C)C)cc2C(C)C)c2ccccc12.
What is the InChIKey of [1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylindol-3-yl] butanoate?
The InChIKey is LLBSXVFKMWKVFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H35NO4S/c1-8-11-26(29)32-25-16-28(24-13-10-9-12-21(24)25)33(30,31)27-22(18(4)5)14-20(17(2)3)15-23(27)19(6)7/h9-10,12-19H,8,11H2,1-7H3.
What are the key properties of [1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylindol-3-yl] butanoate?
[1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylindol-3-yl] butanoate has a molecular weight of 469.65 g/mol, XLogP of 6.95, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylindol-3-yl] butanoate is sourced from PubChem (CID 57201994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).