C22H33NO2 — CID 57202340
7-(cyclohexen-1-yl)-2-octyl-3a,4,5,6-tetrahydroisoindole-1,3-dione (PubChem CID 57202340) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is 7-(cyclohexen-1-yl)-2-octyl-3a,4,5,6-tetrahydroisoindole-1,3-dione.
| Compound Name | 7-(cyclohexen-1-yl)-2-octyl-3a,4,5,6-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 57202340 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | 7-(cyclohexen-1-yl)-2-octyl-3a,4,5,6-tetrahydroisoindole-1,3-dione |
| SMILES | CCCCCCCCN1C(=O)C2=C(C3=CCCCC3)CCCC2C1=O |
| InChI | InChI=1S/C22H33NO2/c1-2-3-4-5-6-10-16-23-21(24)19-15-11-14-18(20(19)22(23)25)17-12-8-7-9-13-17/h12,19H,2-11,13-16H2,1H3 |
| InChIKey | AIEXXCJLFZXPLH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|