C12H17F3N6OS — CID 57202554
N-[1-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylbutyl]formamide (PubChem CID 57202554) has the molecular formula C12H17F3N6OS and a molecular weight of 350.37 g/mol. Its IUPAC name is N-[1-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylbutyl]formamide.
| Compound Name | N-[1-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylbutyl]formamide |
|---|---|
| PubChem CID | 57202554 |
| Molecular Formula | C12H17F3N6OS |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | N-[1-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylbutyl]formamide |
| SMILES | CCCC(NC=O)Sc1nccc(N/C(N)=N/CC(F)(F)F)n1 |
| InChI | InChI=1S/C12H17F3N6OS/c1-2-3-9(19-7-22)23-11-17-5-4-8(21-11)20-10(16)18-6-12(13,14)15/h4-5,7,9H,2-3,6H2,1H3,(H,19,22)(H3,16,17,18,20,21) |
| InChIKey | NNQYEUVHEAGXKI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 105.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|