C18H17NO — CID 57202662
1-methoxy-2,10-dimethyl-5,10-dihydroindeno[1,2-b]indole (PubChem CID 57202662) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is 1-methoxy-2,10-dimethyl-5,10-dihydroindeno[1,2-b]indole.
| Compound Name | 1-methoxy-2,10-dimethyl-5,10-dihydroindeno[1,2-b]indole |
|---|---|
| PubChem CID | 57202662 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 1-methoxy-2,10-dimethyl-5,10-dihydroindeno[1,2-b]indole |
| SMILES | COc1c(C)ccc2c1C(C)c1c-2[nH]c2ccccc12 |
| InChI | InChI=1S/C18H17NO/c1-10-8-9-13-16(18(10)20-3)11(2)15-12-6-4-5-7-14(12)19-17(13)15/h4-9,11,19H,1-3H3 |
| InChIKey | AYGGJBNKMLTRTF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |