About 2-[4-(4,4-dimethylpentoxy)phenyl]-1-propan-2-ylbenzimidazole
2-[4-(4,4-dimethylpentoxy)phenyl]-1-propan-2-ylbenzimidazole (PubChem CID 57203149) has the molecular formula C23H30N2O
and a molecular weight of 350.51 g/mol. Its IUPAC name is 2-[4-(4,4-dimethylpentoxy)phenyl]-1-propan-2-ylbenzimidazole.
Molecular Properties
| Compound Name | 2-[4-(4,4-dimethylpentoxy)phenyl]-1-propan-2-ylbenzimidazole |
| PubChem CID | 57203149 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 2-[4-(4,4-dimethylpentoxy)phenyl]-1-propan-2-ylbenzimidazole |
| SMILES | CC(C)n1c(-c2ccc(OCCCC(C)(C)C)cc2)nc2ccccc21 |
| InChI | InChI=1S/C23H30N2O/c1-17(2)25-21-10-7-6-9-20(21)24-22(25)18-11-13-19(14-12-18)26-16-8-15-23(3,4)5/h6-7,9-14,17H,8,15-16H2,1-5H3 |
| InChIKey | MTSXEVKYLSNHMK-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(4,4-dimethylpentoxy)phenyl]-1-propan-2-ylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4,4-dimethylpentoxy)phenyl]-1-propan-2-ylbenzimidazole?
The IUPAC name of 2-[4-(4,4-dimethylpentoxy)phenyl]-1-propan-2-ylbenzimidazole (CID 57203149) is 2-[4-(4,4-dimethylpentoxy)phenyl]-1-propan-2-ylbenzimidazole.
What is the SMILES notation for 2-[4-(4,4-dimethylpentoxy)phenyl]-1-propan-2-ylbenzimidazole?
The canonical SMILES for 2-[4-(4,4-dimethylpentoxy)phenyl]-1-propan-2-ylbenzimidazole is CC(C)n1c(-c2ccc(OCCCC(C)(C)C)cc2)nc2ccccc21.
What is the InChIKey of 2-[4-(4,4-dimethylpentoxy)phenyl]-1-propan-2-ylbenzimidazole?
The InChIKey is MTSXEVKYLSNHMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N2O/c1-17(2)25-21-10-7-6-9-20(21)24-22(25)18-11-13-19(14-12-18)26-16-8-15-23(3,4)5/h6-7,9-14,17H,8,15-16H2,1-5H3.
What are the key properties of 2-[4-(4,4-dimethylpentoxy)phenyl]-1-propan-2-ylbenzimidazole?
2-[4-(4,4-dimethylpentoxy)phenyl]-1-propan-2-ylbenzimidazole has a molecular weight of 350.51 g/mol, XLogP of 6.49, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4,4-dimethylpentoxy)phenyl]-1-propan-2-ylbenzimidazole is sourced from PubChem (CID 57203149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).