About (3-nitro-2-pyridinyl) 2-hydroxybutanoate
(3-nitro-2-pyridinyl) 2-hydroxybutanoate (PubChem CID 57203374) has the molecular formula C9H10N2O5
and a molecular weight of 226.19 g/mol. Its IUPAC name is (3-nitro-2-pyridinyl) 2-hydroxybutanoate.
Molecular Properties
| Compound Name | (3-nitro-2-pyridinyl) 2-hydroxybutanoate |
| PubChem CID | 57203374 |
| Molecular Formula | C9H10N2O5 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | (3-nitro-2-pyridinyl) 2-hydroxybutanoate |
| SMILES | CCC(O)C(=O)Oc1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10N2O5/c1-2-7(12)9(13)16-8-6(11(14)15)4-3-5-10-8/h3-5,7,12H,2H2,1H3 |
| InChIKey | UIYGUIWPZZMHLN-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-nitro-2-pyridinyl) 2-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-nitro-2-pyridinyl) 2-hydroxybutanoate?
The IUPAC name of (3-nitro-2-pyridinyl) 2-hydroxybutanoate (CID 57203374) is (3-nitro-2-pyridinyl) 2-hydroxybutanoate.
What is the SMILES notation for (3-nitro-2-pyridinyl) 2-hydroxybutanoate?
The canonical SMILES for (3-nitro-2-pyridinyl) 2-hydroxybutanoate is CCC(O)C(=O)Oc1ncccc1[N+](=O)[O-].
What is the InChIKey of (3-nitro-2-pyridinyl) 2-hydroxybutanoate?
The InChIKey is UIYGUIWPZZMHLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O5/c1-2-7(12)9(13)16-8-6(11(14)15)4-3-5-10-8/h3-5,7,12H,2H2,1H3.
What are the key properties of (3-nitro-2-pyridinyl) 2-hydroxybutanoate?
(3-nitro-2-pyridinyl) 2-hydroxybutanoate has a molecular weight of 226.19 g/mol, XLogP of 0.67, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-nitro-2-pyridinyl) 2-hydroxybutanoate is sourced from PubChem (CID 57203374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).