C25H27N3O4 — CID 57203653
ethyl 3-hydroxy-2-[1-(2-phenylquinazoline-4-carbonyl)piperidin-3-yl]propanoate (PubChem CID 57203653) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is ethyl 3-hydroxy-2-[1-(2-phenylquinazoline-4-carbonyl)piperidin-3-yl]propanoate.
| Compound Name | ethyl 3-hydroxy-2-[1-(2-phenylquinazoline-4-carbonyl)piperidin-3-yl]propanoate |
|---|---|
| PubChem CID | 57203653 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | ethyl 3-hydroxy-2-[1-(2-phenylquinazoline-4-carbonyl)piperidin-3-yl]propanoate |
| SMILES | CCOC(=O)C(CO)C1CCCN(C(=O)c2nc(-c3ccccc3)nc3ccccc23)C1 |
| InChI | InChI=1S/C25H27N3O4/c1-2-32-25(31)20(16-29)18-11-8-14-28(15-18)24(30)22-19-12-6-7-13-21(19)26-23(27-22)17-9-4-3-5-10-17/h3-7,9-10,12-13,18,20,29H,2,8,11,14-16H2,1H3 |
| InChIKey | ARTWBEGEOYWEGB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |