C31H39FN2O4 — CID 57204083
(8S,9S,10R,13S,14S,17R)-17-[2-[4-(4-fluorophenyl)piperazin-1-yl]acetyl]-11,17-dihydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 57204083) has the molecular formula C31H39FN2O4 and a molecular weight of 522.66 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17R)-17-[2-[4-(4-fluorophenyl)piperazin-1-yl]acetyl]-11,17-dihydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S,17R)-17-[2-[4-(4-fluorophenyl)piperazin-1-yl]acetyl]-11,17-dihydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57204083 |
| Molecular Formula | C31H39FN2O4 |
| Molecular Weight | 522.66 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | (8S,9S,10R,13S,14S,17R)-17-[2-[4-(4-fluorophenyl)piperazin-1-yl]acetyl]-11,17-dihydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@@H]1[C@@H]2C(O)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C31H39FN2O4/c1-29-11-9-23(35)17-20(29)3-8-24-25-10-12-31(38,30(25,2)18-26(36)28(24)29)27(37)19-33-13-15-34(16-14-33)22-6-4-21(32)5-7-22/h4-7,9,11,17,24-26,28,36,38H,3,8,10,12-16,18-19H2,1-2H3/t24-,25-,26?,28+,29-,30-,31-/m0/s1 |
| InChIKey | QHLJOZJNLZJHBY-BXTHELIYSA-N |
| XLogP | 3.53 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.66 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |