C26H33N5O3S — CID 57204209
(2S)-2-[(3aS,6S,6aR)-6-methyl-5-oxo-4-(1,3-thiazol-2-yl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carbonyl]-N-(4-tert-butylphenyl)pyrrolidine-1-carboxamide (PubChem CID 57204209) has the molecular formula C26H33N5O3S and a molecular weight of 495.65 g/mol. Its IUPAC name is (2S)-2-[(3aS,6S,6aR)-6-methyl-5-oxo-4-(1,3-thiazol-2-yl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carbonyl]-N-(4-tert-butylphenyl)pyrrolidine-1-carboxamide.
| Compound Name | (2S)-2-[(3aS,6S,6aR)-6-methyl-5-oxo-4-(1,3-thiazol-2-yl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carbonyl]-N-(4-tert-butylphenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 57204209 |
| Molecular Formula | C26H33N5O3S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | (2S)-2-[(3aS,6S,6aR)-6-methyl-5-oxo-4-(1,3-thiazol-2-yl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carbonyl]-N-(4-tert-butylphenyl)pyrrolidine-1-carboxamide |
| SMILES | C[C@@H]1C(=O)N(c2nccs2)[C@H]2CCN(C(=O)[C@@H]3CCCN3C(=O)Nc3ccc(C(C)(C)C)cc3)[C@H]12 |
| InChI | InChI=1S/C26H33N5O3S/c1-16-21-19(31(22(16)32)25-27-12-15-35-25)11-14-30(21)23(33)20-6-5-13-29(20)24(34)28-18-9-7-17(8-10-18)26(2,3)4/h7-10,12,15-16,19-21H,5-6,11,13-14H2,1-4H3,(H,28,34)/t16-,19-,20-,21+/m0/s1 |
| InChIKey | DPXHVRAKYXBVAO-LRGNLBRXSA-N |
| XLogP | 4.09 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |