About methyl 2-[2-(3,5-difluorophenyl)ethyl]-5-hydroxy-6-methyl-3-oxoheptanoate
methyl 2-[2-(3,5-difluorophenyl)ethyl]-5-hydroxy-6-methyl-3-oxoheptanoate (PubChem CID 57204480) has the molecular formula C17H22F2O4
and a molecular weight of 328.36 g/mol. Its IUPAC name is methyl 2-[2-(3,5-difluorophenyl)ethyl]-5-hydroxy-6-methyl-3-oxoheptanoate.
Molecular Properties
| Compound Name | methyl 2-[2-(3,5-difluorophenyl)ethyl]-5-hydroxy-6-methyl-3-oxoheptanoate |
| PubChem CID | 57204480 |
| Molecular Formula | C17H22F2O4 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | methyl 2-[2-(3,5-difluorophenyl)ethyl]-5-hydroxy-6-methyl-3-oxoheptanoate |
| SMILES | COC(=O)C(CCc1cc(F)cc(F)c1)C(=O)CC(O)C(C)C |
| InChI | InChI=1S/C17H22F2O4/c1-10(2)15(20)9-16(21)14(17(22)23-3)5-4-11-6-12(18)8-13(19)7-11/h6-8,10,14-15,20H,4-5,9H2,1-3H3 |
| InChIKey | MEOVBDBHUYGGOV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[2-(3,5-difluorophenyl)ethyl]-5-hydroxy-6-methyl-3-oxoheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-(3,5-difluorophenyl)ethyl]-5-hydroxy-6-methyl-3-oxoheptanoate?
The IUPAC name of methyl 2-[2-(3,5-difluorophenyl)ethyl]-5-hydroxy-6-methyl-3-oxoheptanoate (CID 57204480) is methyl 2-[2-(3,5-difluorophenyl)ethyl]-5-hydroxy-6-methyl-3-oxoheptanoate.
What is the SMILES notation for methyl 2-[2-(3,5-difluorophenyl)ethyl]-5-hydroxy-6-methyl-3-oxoheptanoate?
The canonical SMILES for methyl 2-[2-(3,5-difluorophenyl)ethyl]-5-hydroxy-6-methyl-3-oxoheptanoate is COC(=O)C(CCc1cc(F)cc(F)c1)C(=O)CC(O)C(C)C.
What is the InChIKey of methyl 2-[2-(3,5-difluorophenyl)ethyl]-5-hydroxy-6-methyl-3-oxoheptanoate?
The InChIKey is MEOVBDBHUYGGOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22F2O4/c1-10(2)15(20)9-16(21)14(17(22)23-3)5-4-11-6-12(18)8-13(19)7-11/h6-8,10,14-15,20H,4-5,9H2,1-3H3.
What are the key properties of methyl 2-[2-(3,5-difluorophenyl)ethyl]-5-hydroxy-6-methyl-3-oxoheptanoate?
methyl 2-[2-(3,5-difluorophenyl)ethyl]-5-hydroxy-6-methyl-3-oxoheptanoate has a molecular weight of 328.36 g/mol, XLogP of 2.66, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-(3,5-difluorophenyl)ethyl]-5-hydroxy-6-methyl-3-oxoheptanoate is sourced from PubChem (CID 57204480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).