C30H46O4S — CID 57204580
methyl 6-[(4R,5S)-4-hydroxy-5-[(3S,5R)-3-hydroxy-5-methylnon-1-enyl]-2-(2-phenylethyl)cyclopenten-1-yl]sulfanylhexanoate (PubChem CID 57204580) has the molecular formula C30H46O4S and a molecular weight of 502.76 g/mol. Its IUPAC name is methyl 6-[(4R,5S)-4-hydroxy-5-[(3S,5R)-3-hydroxy-5-methylnon-1-enyl]-2-(2-phenylethyl)cyclopenten-1-yl]sulfanylhexanoate.
| Compound Name | methyl 6-[(4R,5S)-4-hydroxy-5-[(3S,5R)-3-hydroxy-5-methylnon-1-enyl]-2-(2-phenylethyl)cyclopenten-1-yl]sulfanylhexanoate |
|---|---|
| PubChem CID | 57204580 |
| Molecular Formula | C30H46O4S |
| Molecular Weight | 502.76 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | methyl 6-[(4R,5S)-4-hydroxy-5-[(3S,5R)-3-hydroxy-5-methylnon-1-enyl]-2-(2-phenylethyl)cyclopenten-1-yl]sulfanylhexanoate |
| SMILES | CCCC[C@@H](C)C[C@H](O)C=C[C@@H]1C(SCCCCCC(=O)OC)=C(CCc2ccccc2)C[C@H]1O |
| InChI | InChI=1S/C30H46O4S/c1-4-5-12-23(2)21-26(31)18-19-27-28(32)22-25(17-16-24-13-8-6-9-14-24)30(27)35-20-11-7-10-15-29(33)34-3/h6,8-9,13-14,18-19,23,26-28,31-32H,4-5,7,10-12,15-17,20-22H2,1-3H3/t23-,26-,27+,28-/m1/s1 |
| InChIKey | BKTSYDBYCQYKFX-NNTQFHGGSA-N |
| XLogP | 6.85 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.76 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|