C30H56O6Si — CID 57204684
8-acetyl-12-[tert-butyl(dimethyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadec-5-enoic acid (PubChem CID 57204684) has the molecular formula C30H56O6Si and a molecular weight of 540.86 g/mol. Its IUPAC name is 8-acetyl-12-[tert-butyl(dimethyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadec-5-enoic acid.
| Compound Name | 8-acetyl-12-[tert-butyl(dimethyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadec-5-enoic acid |
|---|---|
| PubChem CID | 57204684 |
| Molecular Formula | C30H56O6Si |
| Molecular Weight | 540.86 g/mol |
| Exact Mass | 540.38 |
| IUPAC Name | 8-acetyl-12-[tert-butyl(dimethyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadec-5-enoic acid |
| SMILES | CCCCCC(CCCC(CC=CCCC(C(=O)O)[C@H]1COC(C)(C)O1)C(C)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H56O6Si/c1-10-11-13-19-25(36-37(8,9)29(3,4)5)20-16-18-24(23(2)31)17-14-12-15-21-26(28(32)33)27-22-34-30(6,7)35-27/h12,14,24-27H,10-11,13,15-22H2,1-9H3,(H,32,33)/t24?,25?,26?,27-/m1/s1 |
| InChIKey | GISQITDLAFXPSW-VZWKQKHMSA-N |
| XLogP | 7.91 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.86 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|