About tert-butyl (5S)-5-amino-2-(1,3-dioxoisoindol-2-yl)-6-methoxyhex-3-enoate
tert-butyl (5S)-5-amino-2-(1,3-dioxoisoindol-2-yl)-6-methoxyhex-3-enoate (PubChem CID 57205296) has the molecular formula C19H24N2O5
and a molecular weight of 360.41 g/mol. Its IUPAC name is tert-butyl (5S)-5-amino-2-(1,3-dioxoisoindol-2-yl)-6-methoxyhex-3-enoate.
Molecular Properties
| Compound Name | tert-butyl (5S)-5-amino-2-(1,3-dioxoisoindol-2-yl)-6-methoxyhex-3-enoate |
| PubChem CID | 57205296 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | tert-butyl (5S)-5-amino-2-(1,3-dioxoisoindol-2-yl)-6-methoxyhex-3-enoate |
| SMILES | COC[C@@H](N)C=CC(C(=O)OC(C)(C)C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H24N2O5/c1-19(2,3)26-18(24)15(10-9-12(20)11-25-4)21-16(22)13-7-5-6-8-14(13)17(21)23/h5-10,12,15H,11,20H2,1-4H3/t12-,15?/m0/s1 |
| InChIKey | NOSALPXUAGENNG-SFVWDYPZSA-N |
| XLogP | 1.52 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (5S)-5-amino-2-(1,3-dioxoisoindol-2-yl)-6-methoxyhex-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (5S)-5-amino-2-(1,3-dioxoisoindol-2-yl)-6-methoxyhex-3-enoate?
The IUPAC name of tert-butyl (5S)-5-amino-2-(1,3-dioxoisoindol-2-yl)-6-methoxyhex-3-enoate (CID 57205296) is tert-butyl (5S)-5-amino-2-(1,3-dioxoisoindol-2-yl)-6-methoxyhex-3-enoate.
What is the SMILES notation for tert-butyl (5S)-5-amino-2-(1,3-dioxoisoindol-2-yl)-6-methoxyhex-3-enoate?
The canonical SMILES for tert-butyl (5S)-5-amino-2-(1,3-dioxoisoindol-2-yl)-6-methoxyhex-3-enoate is COC[C@@H](N)C=CC(C(=O)OC(C)(C)C)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of tert-butyl (5S)-5-amino-2-(1,3-dioxoisoindol-2-yl)-6-methoxyhex-3-enoate?
The InChIKey is NOSALPXUAGENNG-SFVWDYPZSA-N. The full InChI is InChI=1S/C19H24N2O5/c1-19(2,3)26-18(24)15(10-9-12(20)11-25-4)21-16(22)13-7-5-6-8-14(13)17(21)23/h5-10,12,15H,11,20H2,1-4H3/t12-,15?/m0/s1.
What are the key properties of tert-butyl (5S)-5-amino-2-(1,3-dioxoisoindol-2-yl)-6-methoxyhex-3-enoate?
tert-butyl (5S)-5-amino-2-(1,3-dioxoisoindol-2-yl)-6-methoxyhex-3-enoate has a molecular weight of 360.41 g/mol, XLogP of 1.52, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (5S)-5-amino-2-(1,3-dioxoisoindol-2-yl)-6-methoxyhex-3-enoate is sourced from PubChem (CID 57205296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).