C28H21F3N2O4 — CID 57205569
1-[1-(1,3-benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-3-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one (PubChem CID 57205569) has the molecular formula C28H21F3N2O4 and a molecular weight of 506.48 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-3-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one.
| Compound Name | 1-[1-(1,3-benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-3-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 57205569 |
| Molecular Formula | C28H21F3N2O4 |
| Molecular Weight | 506.48 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-3-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(OC(F)(F)F)cc1)C1Cc2c([nH]c3ccccc23)C(c2ccc3c(c2)OCO3)N1 |
| InChI | InChI=1S/C28H21F3N2O4/c29-28(30,31)37-18-9-5-16(6-10-18)7-11-23(34)22-14-20-19-3-1-2-4-21(19)32-27(20)26(33-22)17-8-12-24-25(13-17)36-15-35-24/h1-13,22,26,32-33H,14-15H2 |
| InChIKey | KSPBDBAPRXRHET-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.48 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|