C31H32O7S — CID 57205939
2-[1-hydroxy-3,3,3-tris(4-methoxyphenyl)propyl]-4-methylbenzenesulfonic acid (PubChem CID 57205939) has the molecular formula C31H32O7S and a molecular weight of 548.66 g/mol. Its IUPAC name is 2-[1-hydroxy-3,3,3-tris(4-methoxyphenyl)propyl]-4-methylbenzenesulfonic acid.
| Compound Name | 2-[1-hydroxy-3,3,3-tris(4-methoxyphenyl)propyl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 57205939 |
| Molecular Formula | C31H32O7S |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | 2-[1-hydroxy-3,3,3-tris(4-methoxyphenyl)propyl]-4-methylbenzenesulfonic acid |
| SMILES | COc1ccc(C(CC(O)c2cc(C)ccc2S(=O)(=O)O)(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H32O7S/c1-21-5-18-30(39(33,34)35)28(19-21)29(32)20-31(22-6-12-25(36-2)13-7-22,23-8-14-26(37-3)15-9-23)24-10-16-27(38-4)17-11-24/h5-19,29,32H,20H2,1-4H3,(H,33,34,35) |
| InChIKey | ABTVGOVGLZOJRS-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|