C11H15N5O2S — CID 57206664
2-amino-8-[(1R,3S,4R)-3-hydroxy-4-(hydroxymethyl)cyclopentyl]-3,7-dihydropurine-6-thione (PubChem CID 57206664) has the molecular formula C11H15N5O2S and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-amino-8-[(1R,3S,4R)-3-hydroxy-4-(hydroxymethyl)cyclopentyl]-3,7-dihydropurine-6-thione.
| Compound Name | 2-amino-8-[(1R,3S,4R)-3-hydroxy-4-(hydroxymethyl)cyclopentyl]-3,7-dihydropurine-6-thione |
|---|---|
| PubChem CID | 57206664 |
| Molecular Formula | C11H15N5O2S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2-amino-8-[(1R,3S,4R)-3-hydroxy-4-(hydroxymethyl)cyclopentyl]-3,7-dihydropurine-6-thione |
| SMILES | Nc1nc(=S)c2[nH]c([C@@H]3C[C@H](CO)[C@@H](O)C3)nc2[nH]1 |
| InChI | InChI=1S/C11H15N5O2S/c12-11-15-9-7(10(19)16-11)13-8(14-9)4-1-5(3-17)6(18)2-4/h4-6,17-18H,1-3H2,(H4,12,13,14,15,16,19)/t4-,5-,6+/m1/s1 |
| InChIKey | LWRCWWZCKGZWIV-PBXRRBTRSA-N |
| XLogP | 0.44 |
| TPSA | 123.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|