C28H28O2 — CID 57206677
2-(2,7-ditert-butylphenanthren-1-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 57206677) has the molecular formula C28H28O2 and a molecular weight of 396.53 g/mol. Its IUPAC name is 2-(2,7-ditert-butylphenanthren-1-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(2,7-ditert-butylphenanthren-1-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 57206677 |
| Molecular Formula | C28H28O2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 2-(2,7-ditert-butylphenanthren-1-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(C)(C)c1ccc2c(ccc3c(C4=CC(=O)C=CC4=O)c(C(C)(C)C)ccc32)c1 |
| InChI | InChI=1S/C28H28O2/c1-27(2,3)18-8-11-20-17(15-18)7-10-22-21(20)12-13-24(28(4,5)6)26(22)23-16-19(29)9-14-25(23)30/h7-16H,1-6H3 |
| InChIKey | NWMZJVIOWIBRHP-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|