C20H28F3NO2S — CID 57206722
2-(3-phenylpropyl)-3-(8,8,8-trifluoro-3-hydroxyoctyl)-1,3-thiazolidin-4-one (PubChem CID 57206722) has the molecular formula C20H28F3NO2S and a molecular weight of 403.51 g/mol. Its IUPAC name is 2-(3-phenylpropyl)-3-(8,8,8-trifluoro-3-hydroxyoctyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(3-phenylpropyl)-3-(8,8,8-trifluoro-3-hydroxyoctyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 57206722 |
| Molecular Formula | C20H28F3NO2S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 2-(3-phenylpropyl)-3-(8,8,8-trifluoro-3-hydroxyoctyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(CCCc2ccccc2)N1CCC(O)CCCCC(F)(F)F |
| InChI | InChI=1S/C20H28F3NO2S/c21-20(22,23)13-5-4-10-17(25)12-14-24-18(26)15-27-19(24)11-6-9-16-7-2-1-3-8-16/h1-3,7-8,17,19,25H,4-6,9-15H2 |
| InChIKey | QPIMSEMEJFFOIR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|