About dodecan-6-yl benzenesulfonate
dodecan-6-yl benzenesulfonate (PubChem CID 57206723) has the molecular formula C18H30O3S
and a molecular weight of 326.50 g/mol. Its IUPAC name is dodecan-6-yl benzenesulfonate.
Molecular Properties
| Compound Name | dodecan-6-yl benzenesulfonate |
| PubChem CID | 57206723 |
| Molecular Formula | C18H30O3S |
| Molecular Weight | 326.50 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | dodecan-6-yl benzenesulfonate |
| SMILES | CCCCCCC(CCCCC)OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H30O3S/c1-3-5-7-10-14-17(13-9-6-4-2)21-22(19,20)18-15-11-8-12-16-18/h8,11-12,15-17H,3-7,9-10,13-14H2,1-2H3 |
| InChIKey | SBNNWCXKFFKLMG-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.50 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze dodecan-6-yl benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecan-6-yl benzenesulfonate?
The IUPAC name of dodecan-6-yl benzenesulfonate (CID 57206723) is dodecan-6-yl benzenesulfonate.
What is the SMILES notation for dodecan-6-yl benzenesulfonate?
The canonical SMILES for dodecan-6-yl benzenesulfonate is CCCCCCC(CCCCC)OS(=O)(=O)c1ccccc1.
What is the InChIKey of dodecan-6-yl benzenesulfonate?
The InChIKey is SBNNWCXKFFKLMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O3S/c1-3-5-7-10-14-17(13-9-6-4-2)21-22(19,20)18-15-11-8-12-16-18/h8,11-12,15-17H,3-7,9-10,13-14H2,1-2H3.
What are the key properties of dodecan-6-yl benzenesulfonate?
dodecan-6-yl benzenesulfonate has a molecular weight of 326.50 g/mol, XLogP of 5.31, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dodecan-6-yl benzenesulfonate is sourced from PubChem (CID 57206723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).