About 6-amino-5-ethylhexane-1,3,6-triol
6-amino-5-ethylhexane-1,3,6-triol (PubChem CID 57206962) has the molecular formula C8H19NO3
and a molecular weight of 177.24 g/mol. Its IUPAC name is 6-amino-5-ethylhexane-1,3,6-triol.
Molecular Properties
| Compound Name | 6-amino-5-ethylhexane-1,3,6-triol |
| PubChem CID | 57206962 |
| Molecular Formula | C8H19NO3 |
| Molecular Weight | 177.24 g/mol |
| Exact Mass | 177.14 |
| IUPAC Name | 6-amino-5-ethylhexane-1,3,6-triol |
| SMILES | CCC(CC(O)CCO)C(N)O |
| InChI | InChI=1S/C8H19NO3/c1-2-6(8(9)12)5-7(11)3-4-10/h6-8,10-12H,2-5,9H2,1H3 |
| InChIKey | ZRTKWNDXZBDBMV-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.24 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-5-ethylhexane-1,3,6-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-ethylhexane-1,3,6-triol?
The IUPAC name of 6-amino-5-ethylhexane-1,3,6-triol (CID 57206962) is 6-amino-5-ethylhexane-1,3,6-triol.
What is the SMILES notation for 6-amino-5-ethylhexane-1,3,6-triol?
The canonical SMILES for 6-amino-5-ethylhexane-1,3,6-triol is CCC(CC(O)CCO)C(N)O.
What is the InChIKey of 6-amino-5-ethylhexane-1,3,6-triol?
The InChIKey is ZRTKWNDXZBDBMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO3/c1-2-6(8(9)12)5-7(11)3-4-10/h6-8,10-12H,2-5,9H2,1H3.
What are the key properties of 6-amino-5-ethylhexane-1,3,6-triol?
6-amino-5-ethylhexane-1,3,6-triol has a molecular weight of 177.24 g/mol, XLogP of -0.58, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-ethylhexane-1,3,6-triol is sourced from PubChem (CID 57206962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).