About indazole-1-sulfinate
indazole-1-sulfinate (PubChem CID 57207167) has the molecular formula C7H5N2O2S-
and a molecular weight of 181.20 g/mol. Its IUPAC name is indazole-1-sulfinate.
Molecular Properties
| Compound Name | indazole-1-sulfinate |
| PubChem CID | 57207167 |
| Molecular Formula | C7H5N2O2S- |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.01 |
| IUPAC Name | indazole-1-sulfinate |
| SMILES | O=S([O-])n1ncc2ccccc21 |
| InChI | InChI=1S/C7H6N2O2S/c10-12(11)9-7-4-2-1-3-6(7)5-8-9/h1-5H,(H,10,11)/p-1 |
| InChIKey | RSSNDZFZDWUTDT-UHFFFAOYSA-M |
| XLogP | 0.68 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze indazole-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indazole-1-sulfinate?
The IUPAC name of indazole-1-sulfinate (CID 57207167) is indazole-1-sulfinate.
What is the SMILES notation for indazole-1-sulfinate?
The canonical SMILES for indazole-1-sulfinate is O=S([O-])n1ncc2ccccc21.
What is the InChIKey of indazole-1-sulfinate?
The InChIKey is RSSNDZFZDWUTDT-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6N2O2S/c10-12(11)9-7-4-2-1-3-6(7)5-8-9/h1-5H,(H,10,11)/p-1.
What are the key properties of indazole-1-sulfinate?
indazole-1-sulfinate has a molecular weight of 181.20 g/mol, XLogP of 0.68, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for indazole-1-sulfinate is sourced from PubChem (CID 57207167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).