C16H23NO2 — CID 57207521
(3aS,7aR)-4-(2-methoxyphenyl)-6-methyl-1,2,3,3a,5,6,7,7a-octahydroisoindol-4-ol (PubChem CID 57207521) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is (3aS,7aR)-4-(2-methoxyphenyl)-6-methyl-1,2,3,3a,5,6,7,7a-octahydroisoindol-4-ol.
| Compound Name | (3aS,7aR)-4-(2-methoxyphenyl)-6-methyl-1,2,3,3a,5,6,7,7a-octahydroisoindol-4-ol |
|---|---|
| PubChem CID | 57207521 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (3aS,7aR)-4-(2-methoxyphenyl)-6-methyl-1,2,3,3a,5,6,7,7a-octahydroisoindol-4-ol |
| SMILES | COc1ccccc1C1(O)CC(C)C[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C16H23NO2/c1-11-7-12-9-17-10-14(12)16(18,8-11)13-5-3-4-6-15(13)19-2/h3-6,11-12,14,17-18H,7-10H2,1-2H3/t11?,12-,14+,16?/m0/s1 |
| InChIKey | PUVNHYZGMUTALJ-QRFPHZIJSA-N |
| XLogP | 2.15 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |