About 4-bromo-1,1,2-trifluorobut-2-ene
4-bromo-1,1,2-trifluorobut-2-ene (PubChem CID 57208025) has the molecular formula C4H4BrF3
and a molecular weight of 188.97 g/mol. Its IUPAC name is 4-bromo-1,1,2-trifluorobut-2-ene.
Molecular Properties
| Compound Name | 4-bromo-1,1,2-trifluorobut-2-ene |
| PubChem CID | 57208025 |
| Molecular Formula | C4H4BrF3 |
| Molecular Weight | 188.97 g/mol |
| Exact Mass | 187.94 |
| IUPAC Name | 4-bromo-1,1,2-trifluorobut-2-ene |
| SMILES | FC(=CCBr)C(F)F |
| InChI | InChI=1S/C4H4BrF3/c5-2-1-3(6)4(7)8/h1,4H,2H2 |
| InChIKey | AJLGZFYBPSPRLK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.97 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-1,1,2-trifluorobut-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1,1,2-trifluorobut-2-ene?
The IUPAC name of 4-bromo-1,1,2-trifluorobut-2-ene (CID 57208025) is 4-bromo-1,1,2-trifluorobut-2-ene.
What is the SMILES notation for 4-bromo-1,1,2-trifluorobut-2-ene?
The canonical SMILES for 4-bromo-1,1,2-trifluorobut-2-ene is FC(=CCBr)C(F)F.
What is the InChIKey of 4-bromo-1,1,2-trifluorobut-2-ene?
The InChIKey is AJLGZFYBPSPRLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4BrF3/c5-2-1-3(6)4(7)8/h1,4H,2H2.
What are the key properties of 4-bromo-1,1,2-trifluorobut-2-ene?
4-bromo-1,1,2-trifluorobut-2-ene has a molecular weight of 188.97 g/mol, XLogP of 2.50, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1,1,2-trifluorobut-2-ene is sourced from PubChem (CID 57208025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).