C30H43ClN2 — CID 57208155
1-N-but-2-enyl-1-(4-chlorophenyl)-4-N-(3,5-dimethylphenyl)-1-N,4-N-dipropylcyclohexane-1,4-diamine (PubChem CID 57208155) has the molecular formula C30H43ClN2 and a molecular weight of 467.14 g/mol. Its IUPAC name is 1-N-but-2-enyl-1-(4-chlorophenyl)-4-N-(3,5-dimethylphenyl)-1-N,4-N-dipropylcyclohexane-1,4-diamine.
| Compound Name | 1-N-but-2-enyl-1-(4-chlorophenyl)-4-N-(3,5-dimethylphenyl)-1-N,4-N-dipropylcyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 57208155 |
| Molecular Formula | C30H43ClN2 |
| Molecular Weight | 467.14 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | 1-N-but-2-enyl-1-(4-chlorophenyl)-4-N-(3,5-dimethylphenyl)-1-N,4-N-dipropylcyclohexane-1,4-diamine |
| SMILES | CC=CCN(CCC)C1(c2ccc(Cl)cc2)CCC(N(CCC)c2cc(C)cc(C)c2)CC1 |
| InChI | InChI=1S/C30H43ClN2/c1-6-9-20-32(18-7-2)30(26-10-12-27(31)13-11-26)16-14-28(15-17-30)33(19-8-3)29-22-24(4)21-25(5)23-29/h6,9-13,21-23,28H,7-8,14-20H2,1-5H3 |
| InChIKey | USVNBXIOAJGDIY-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.14 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|