C19H23NS — CID 57208211
6-(4-butylphenyl)sulfanyl-6,7,8,8a-tetrahydroquinoline (PubChem CID 57208211) has the molecular formula C19H23NS and a molecular weight of 297.47 g/mol. Its IUPAC name is 6-(4-butylphenyl)sulfanyl-6,7,8,8a-tetrahydroquinoline.
| Compound Name | 6-(4-butylphenyl)sulfanyl-6,7,8,8a-tetrahydroquinoline |
|---|---|
| PubChem CID | 57208211 |
| Molecular Formula | C19H23NS |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 6-(4-butylphenyl)sulfanyl-6,7,8,8a-tetrahydroquinoline |
| SMILES | CCCCc1ccc(SC2C=C3C=CC=NC3CC2)cc1 |
| InChI | InChI=1S/C19H23NS/c1-2-3-5-15-7-9-17(10-8-15)21-18-11-12-19-16(14-18)6-4-13-20-19/h4,6-10,13-14,18-19H,2-3,5,11-12H2,1H3 |
| InChIKey | GLNOZYZCIMFNKN-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |