About 1-aminooct-4-ene-1,8-diol
1-aminooct-4-ene-1,8-diol (PubChem CID 57208307) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is 1-aminooct-4-ene-1,8-diol.
Molecular Properties
| Compound Name | 1-aminooct-4-ene-1,8-diol |
| PubChem CID | 57208307 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 1-aminooct-4-ene-1,8-diol |
| SMILES | NC(O)CCC=CCCCO |
| InChI | InChI=1S/C8H17NO2/c9-8(11)6-4-2-1-3-5-7-10/h1-2,8,10-11H,3-7,9H2 |
| InChIKey | CQDKCFSGTYGXHE-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-aminooct-4-ene-1,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminooct-4-ene-1,8-diol?
The IUPAC name of 1-aminooct-4-ene-1,8-diol (CID 57208307) is 1-aminooct-4-ene-1,8-diol.
What is the SMILES notation for 1-aminooct-4-ene-1,8-diol?
The canonical SMILES for 1-aminooct-4-ene-1,8-diol is NC(O)CCC=CCCCO.
What is the InChIKey of 1-aminooct-4-ene-1,8-diol?
The InChIKey is CQDKCFSGTYGXHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2/c9-8(11)6-4-2-1-3-5-7-10/h1-2,8,10-11H,3-7,9H2.
What are the key properties of 1-aminooct-4-ene-1,8-diol?
1-aminooct-4-ene-1,8-diol has a molecular weight of 159.23 g/mol, XLogP of 0.37, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminooct-4-ene-1,8-diol is sourced from PubChem (CID 57208307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).