About 3-methyl-1H-benzo[f][2,1,3]benzothiadiazole
3-methyl-1H-benzo[f][2,1,3]benzothiadiazole (PubChem CID 57208382) has the molecular formula C11H10N2S
and a molecular weight of 202.28 g/mol. Its IUPAC name is 3-methyl-1H-benzo[f][2,1,3]benzothiadiazole.
Molecular Properties
| Compound Name | 3-methyl-1H-benzo[f][2,1,3]benzothiadiazole |
| PubChem CID | 57208382 |
| Molecular Formula | C11H10N2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 3-methyl-1H-benzo[f][2,1,3]benzothiadiazole |
| SMILES | CN1SNc2cc3ccccc3cc21 |
| InChI | InChI=1S/C11H10N2S/c1-13-11-7-9-5-3-2-4-8(9)6-10(11)12-14-13/h2-7,12H,1H3 |
| InChIKey | MTQVOCJHMHSOOT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1H-benzo[f][2,1,3]benzothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1H-benzo[f][2,1,3]benzothiadiazole?
The IUPAC name of 3-methyl-1H-benzo[f][2,1,3]benzothiadiazole (CID 57208382) is 3-methyl-1H-benzo[f][2,1,3]benzothiadiazole.
What is the SMILES notation for 3-methyl-1H-benzo[f][2,1,3]benzothiadiazole?
The canonical SMILES for 3-methyl-1H-benzo[f][2,1,3]benzothiadiazole is CN1SNc2cc3ccccc3cc21.
What is the InChIKey of 3-methyl-1H-benzo[f][2,1,3]benzothiadiazole?
The InChIKey is MTQVOCJHMHSOOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2S/c1-13-11-7-9-5-3-2-4-8(9)6-10(11)12-14-13/h2-7,12H,1H3.
What are the key properties of 3-methyl-1H-benzo[f][2,1,3]benzothiadiazole?
3-methyl-1H-benzo[f][2,1,3]benzothiadiazole has a molecular weight of 202.28 g/mol, XLogP of 3.26, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1H-benzo[f][2,1,3]benzothiadiazole is sourced from PubChem (CID 57208382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).