C10H17N3O5S — CID 57208651
(2S)-2-[(3-acetamidosulfanyl-2-methylpropanoyl)amino]-4-amino-4-oxobutanoic acid (PubChem CID 57208651) has the molecular formula C10H17N3O5S and a molecular weight of 291.33 g/mol. Its IUPAC name is (2S)-2-[(3-acetamidosulfanyl-2-methylpropanoyl)amino]-4-amino-4-oxobutanoic acid.
| Compound Name | (2S)-2-[(3-acetamidosulfanyl-2-methylpropanoyl)amino]-4-amino-4-oxobutanoic acid |
|---|---|
| PubChem CID | 57208651 |
| Molecular Formula | C10H17N3O5S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | (2S)-2-[(3-acetamidosulfanyl-2-methylpropanoyl)amino]-4-amino-4-oxobutanoic acid |
| SMILES | CC(=O)NSCC(C)C(=O)N[C@@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C10H17N3O5S/c1-5(4-19-13-6(2)14)9(16)12-7(10(17)18)3-8(11)15/h5,7H,3-4H2,1-2H3,(H2,11,15)(H,12,16)(H,13,14)(H,17,18)/t5?,7-/m0/s1 |
| InChIKey | HQSADOBUBQJACH-MSZQBOFLSA-N |
| XLogP | -1.15 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|