About 1-dodecyl-6-hydroxy-4,5-dimethylpyridin-2-one
1-dodecyl-6-hydroxy-4,5-dimethylpyridin-2-one (PubChem CID 57208717) has the molecular formula C19H33NO2
and a molecular weight of 307.48 g/mol. Its IUPAC name is 1-dodecyl-6-hydroxy-4,5-dimethylpyridin-2-one.
Molecular Properties
| Compound Name | 1-dodecyl-6-hydroxy-4,5-dimethylpyridin-2-one |
| PubChem CID | 57208717 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | 1-dodecyl-6-hydroxy-4,5-dimethylpyridin-2-one |
| SMILES | CCCCCCCCCCCCn1c(O)c(C)c(C)cc1=O |
| InChI | InChI=1S/C19H33NO2/c1-4-5-6-7-8-9-10-11-12-13-14-20-18(21)15-16(2)17(3)19(20)22/h15,22H,4-14H2,1-3H3 |
| InChIKey | OQKUDTHHJVEUOV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-dodecyl-6-hydroxy-4,5-dimethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-dodecyl-6-hydroxy-4,5-dimethylpyridin-2-one?
The IUPAC name of 1-dodecyl-6-hydroxy-4,5-dimethylpyridin-2-one (CID 57208717) is 1-dodecyl-6-hydroxy-4,5-dimethylpyridin-2-one.
What is the SMILES notation for 1-dodecyl-6-hydroxy-4,5-dimethylpyridin-2-one?
The canonical SMILES for 1-dodecyl-6-hydroxy-4,5-dimethylpyridin-2-one is CCCCCCCCCCCCn1c(O)c(C)c(C)cc1=O.
What is the InChIKey of 1-dodecyl-6-hydroxy-4,5-dimethylpyridin-2-one?
The InChIKey is OQKUDTHHJVEUOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H33NO2/c1-4-5-6-7-8-9-10-11-12-13-14-20-18(21)15-16(2)17(3)19(20)22/h15,22H,4-14H2,1-3H3.
What are the key properties of 1-dodecyl-6-hydroxy-4,5-dimethylpyridin-2-one?
1-dodecyl-6-hydroxy-4,5-dimethylpyridin-2-one has a molecular weight of 307.48 g/mol, XLogP of 5.09, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-dodecyl-6-hydroxy-4,5-dimethylpyridin-2-one is sourced from PubChem (CID 57208717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).