About ethoxymethanesulfinic acid
ethoxymethanesulfinic acid (PubChem CID 57208749) has the molecular formula C3H8O3S
and a molecular weight of 124.16 g/mol. Its IUPAC name is ethoxymethanesulfinic acid.
Molecular Properties
| Compound Name | ethoxymethanesulfinic acid |
| PubChem CID | 57208749 |
| Molecular Formula | C3H8O3S |
| Molecular Weight | 124.16 g/mol |
| Exact Mass | 124.02 |
| IUPAC Name | ethoxymethanesulfinic acid |
| SMILES | CCOCS(=O)O |
| InChI | InChI=1S/C3H8O3S/c1-2-6-3-7(4)5/h2-3H2,1H3,(H,4,5) |
| InChIKey | YVIIZNIUGTZCNG-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.16 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze ethoxymethanesulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxymethanesulfinic acid?
The IUPAC name of ethoxymethanesulfinic acid (CID 57208749) is ethoxymethanesulfinic acid.
What is the SMILES notation for ethoxymethanesulfinic acid?
The canonical SMILES for ethoxymethanesulfinic acid is CCOCS(=O)O.
What is the InChIKey of ethoxymethanesulfinic acid?
The InChIKey is YVIIZNIUGTZCNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O3S/c1-2-6-3-7(4)5/h2-3H2,1H3,(H,4,5).
What are the key properties of ethoxymethanesulfinic acid?
ethoxymethanesulfinic acid has a molecular weight of 124.16 g/mol, XLogP of 0.20, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxymethanesulfinic acid is sourced from PubChem (CID 57208749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).