C29H31N3O4 — CID 57208879
3-[2-[4-(2,4-dimethylphenyl)-6-[2-(3-hydroxypropoxy)phenyl]-1,3,5-triazin-2-yl]phenoxy]propan-1-ol (PubChem CID 57208879) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is 3-[2-[4-(2,4-dimethylphenyl)-6-[2-(3-hydroxypropoxy)phenyl]-1,3,5-triazin-2-yl]phenoxy]propan-1-ol.
| Compound Name | 3-[2-[4-(2,4-dimethylphenyl)-6-[2-(3-hydroxypropoxy)phenyl]-1,3,5-triazin-2-yl]phenoxy]propan-1-ol |
|---|---|
| PubChem CID | 57208879 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 3-[2-[4-(2,4-dimethylphenyl)-6-[2-(3-hydroxypropoxy)phenyl]-1,3,5-triazin-2-yl]phenoxy]propan-1-ol |
| SMILES | Cc1ccc(-c2nc(-c3ccccc3OCCCO)nc(-c3ccccc3OCCCO)n2)c(C)c1 |
| InChI | InChI=1S/C29H31N3O4/c1-20-13-14-22(21(2)19-20)27-30-28(23-9-3-5-11-25(23)35-17-7-15-33)32-29(31-27)24-10-4-6-12-26(24)36-18-8-16-34/h3-6,9-14,19,33-34H,7-8,15-18H2,1-2H3 |
| InChIKey | WOYSNUFVPCTVRM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 97.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|