C16H17N3O3S — CID 57209097
[3-(5-ethyl-1,3,4-oxadiazol-2-yl)-2-methyl-1,2-benzothiazin-4-yl] propanoate (PubChem CID 57209097) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is [3-(5-ethyl-1,3,4-oxadiazol-2-yl)-2-methyl-1,2-benzothiazin-4-yl] propanoate.
| Compound Name | [3-(5-ethyl-1,3,4-oxadiazol-2-yl)-2-methyl-1,2-benzothiazin-4-yl] propanoate |
|---|---|
| PubChem CID | 57209097 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | [3-(5-ethyl-1,3,4-oxadiazol-2-yl)-2-methyl-1,2-benzothiazin-4-yl] propanoate |
| SMILES | CCC(=O)OC1=C(c2nnc(CC)o2)N(C)Sc2ccccc21 |
| InChI | InChI=1S/C16H17N3O3S/c1-4-12-17-18-16(21-12)14-15(22-13(20)5-2)10-8-6-7-9-11(10)23-19(14)3/h6-9H,4-5H2,1-3H3 |
| InChIKey | ZMYAWGZWSBJWAL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|