C12H11F11O2 — CID 57209518
4-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)cyclohexane-1-carboxylic acid (PubChem CID 57209518) has the molecular formula C12H11F11O2 and a molecular weight of 396.20 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 57209518 |
| Molecular Formula | C12H11F11O2 |
| Molecular Weight | 396.20 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 4-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H11F11O2/c13-8(14,6-3-1-5(2-4-6)7(24)25)9(15,16)10(17,18)11(19,20)12(21,22)23/h5-6H,1-4H2,(H,24,25) |
| InChIKey | BLCCCCKQIIVTLU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.20 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|