About 3-(furan-2-yl)-2,5-dimethylpiperidin-4-ol
3-(furan-2-yl)-2,5-dimethylpiperidin-4-ol (PubChem CID 57209626) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is 3-(furan-2-yl)-2,5-dimethylpiperidin-4-ol.
Molecular Properties
| Compound Name | 3-(furan-2-yl)-2,5-dimethylpiperidin-4-ol |
| PubChem CID | 57209626 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 3-(furan-2-yl)-2,5-dimethylpiperidin-4-ol |
| SMILES | CC1CNC(C)C(c2ccco2)C1O |
| InChI | InChI=1S/C11H17NO2/c1-7-6-12-8(2)10(11(7)13)9-4-3-5-14-9/h3-5,7-8,10-13H,6H2,1-2H3 |
| InChIKey | CXKMUAYRBRWWNL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(furan-2-yl)-2,5-dimethylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(furan-2-yl)-2,5-dimethylpiperidin-4-ol?
The IUPAC name of 3-(furan-2-yl)-2,5-dimethylpiperidin-4-ol (CID 57209626) is 3-(furan-2-yl)-2,5-dimethylpiperidin-4-ol.
What is the SMILES notation for 3-(furan-2-yl)-2,5-dimethylpiperidin-4-ol?
The canonical SMILES for 3-(furan-2-yl)-2,5-dimethylpiperidin-4-ol is CC1CNC(C)C(c2ccco2)C1O.
What is the InChIKey of 3-(furan-2-yl)-2,5-dimethylpiperidin-4-ol?
The InChIKey is CXKMUAYRBRWWNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2/c1-7-6-12-8(2)10(11(7)13)9-4-3-5-14-9/h3-5,7-8,10-13H,6H2,1-2H3.
What are the key properties of 3-(furan-2-yl)-2,5-dimethylpiperidin-4-ol?
3-(furan-2-yl)-2,5-dimethylpiperidin-4-ol has a molecular weight of 195.26 g/mol, XLogP of 1.35, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(furan-2-yl)-2,5-dimethylpiperidin-4-ol is sourced from PubChem (CID 57209626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).