About ethyl 2-[[3-bromo-4-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl]diazenyl]propanoate
ethyl 2-[[3-bromo-4-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl]diazenyl]propanoate (PubChem CID 57209862) has the molecular formula C17H22BrN3O4
and a molecular weight of 412.28 g/mol. Its IUPAC name is ethyl 2-[[3-bromo-4-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl]diazenyl]propanoate.
Molecular Properties
| Compound Name | ethyl 2-[[3-bromo-4-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl]diazenyl]propanoate |
| PubChem CID | 57209862 |
| Molecular Formula | C17H22BrN3O4 |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | ethyl 2-[[3-bromo-4-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl]diazenyl]propanoate |
| SMILES | CCOC(=O)C(C)/N=N/c1ccc(CN2OCC(C)(C)C2=O)c(Br)c1 |
| InChI | InChI=1S/C17H22BrN3O4/c1-5-24-15(22)11(2)19-20-13-7-6-12(14(18)8-13)9-21-16(23)17(3,4)10-25-21/h6-8,11H,5,9-10H2,1-4H3/b20-19+ |
| InChIKey | QYMLLMSSBQBMKZ-FMQUCBEESA-N |
| XLogP | 3.78 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[[3-bromo-4-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl]diazenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[3-bromo-4-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl]diazenyl]propanoate?
The IUPAC name of ethyl 2-[[3-bromo-4-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl]diazenyl]propanoate (CID 57209862) is ethyl 2-[[3-bromo-4-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl]diazenyl]propanoate.
What is the SMILES notation for ethyl 2-[[3-bromo-4-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl]diazenyl]propanoate?
The canonical SMILES for ethyl 2-[[3-bromo-4-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl]diazenyl]propanoate is CCOC(=O)C(C)/N=N/c1ccc(CN2OCC(C)(C)C2=O)c(Br)c1.
What is the InChIKey of ethyl 2-[[3-bromo-4-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl]diazenyl]propanoate?
The InChIKey is QYMLLMSSBQBMKZ-FMQUCBEESA-N. The full InChI is InChI=1S/C17H22BrN3O4/c1-5-24-15(22)11(2)19-20-13-7-6-12(14(18)8-13)9-21-16(23)17(3,4)10-25-21/h6-8,11H,5,9-10H2,1-4H3/b20-19+.
What are the key properties of ethyl 2-[[3-bromo-4-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl]diazenyl]propanoate?
ethyl 2-[[3-bromo-4-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl]diazenyl]propanoate has a molecular weight of 412.28 g/mol, XLogP of 3.78, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[3-bromo-4-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl]diazenyl]propanoate is sourced from PubChem (CID 57209862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).