About 2-[(4-ethylsulfonyl-2,3-difluorophenyl)-difluoromethoxy]oxane
2-[(4-ethylsulfonyl-2,3-difluorophenyl)-difluoromethoxy]oxane (PubChem CID 57210044) has the molecular formula C14H16F4O4S
and a molecular weight of 356.34 g/mol. Its IUPAC name is 2-[(4-ethylsulfonyl-2,3-difluorophenyl)-difluoromethoxy]oxane.
Molecular Properties
| Compound Name | 2-[(4-ethylsulfonyl-2,3-difluorophenyl)-difluoromethoxy]oxane |
| PubChem CID | 57210044 |
| Molecular Formula | C14H16F4O4S |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 2-[(4-ethylsulfonyl-2,3-difluorophenyl)-difluoromethoxy]oxane |
| SMILES | CCS(=O)(=O)c1ccc(C(F)(F)OC2CCCCO2)c(F)c1F |
| InChI | InChI=1S/C14H16F4O4S/c1-2-23(19,20)10-7-6-9(12(15)13(10)16)14(17,18)22-11-5-3-4-8-21-11/h6-7,11H,2-5,8H2,1H3 |
| InChIKey | FTSJUTZFAQFXSU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4-ethylsulfonyl-2,3-difluorophenyl)-difluoromethoxy]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-ethylsulfonyl-2,3-difluorophenyl)-difluoromethoxy]oxane?
The IUPAC name of 2-[(4-ethylsulfonyl-2,3-difluorophenyl)-difluoromethoxy]oxane (CID 57210044) is 2-[(4-ethylsulfonyl-2,3-difluorophenyl)-difluoromethoxy]oxane.
What is the SMILES notation for 2-[(4-ethylsulfonyl-2,3-difluorophenyl)-difluoromethoxy]oxane?
The canonical SMILES for 2-[(4-ethylsulfonyl-2,3-difluorophenyl)-difluoromethoxy]oxane is CCS(=O)(=O)c1ccc(C(F)(F)OC2CCCCO2)c(F)c1F.
What is the InChIKey of 2-[(4-ethylsulfonyl-2,3-difluorophenyl)-difluoromethoxy]oxane?
The InChIKey is FTSJUTZFAQFXSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F4O4S/c1-2-23(19,20)10-7-6-9(12(15)13(10)16)14(17,18)22-11-5-3-4-8-21-11/h6-7,11H,2-5,8H2,1H3.
What are the key properties of 2-[(4-ethylsulfonyl-2,3-difluorophenyl)-difluoromethoxy]oxane?
2-[(4-ethylsulfonyl-2,3-difluorophenyl)-difluoromethoxy]oxane has a molecular weight of 356.34 g/mol, XLogP of 3.35, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-ethylsulfonyl-2,3-difluorophenyl)-difluoromethoxy]oxane is sourced from PubChem (CID 57210044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).