About 5-but-2-ynyldodeca-5,6-dien-1,9-diyne
5-but-2-ynyldodeca-5,6-dien-1,9-diyne (PubChem CID 57210444) has the molecular formula C16H18
and a molecular weight of 210.32 g/mol. Its IUPAC name is 5-but-2-ynyldodeca-5,6-dien-1,9-diyne.
Molecular Properties
| Compound Name | 5-but-2-ynyldodeca-5,6-dien-1,9-diyne |
| PubChem CID | 57210444 |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 5-but-2-ynyldodeca-5,6-dien-1,9-diyne |
| SMILES | C#CCCC(=C=CCC#CCC)CC#CC |
| InChI | InChI=1S/C16H18/c1-4-7-10-11-12-15-16(13-8-5-2)14-9-6-3/h2,12H,4,8,11,13-14H2,1,3H3 |
| InChIKey | HBWVSVGNEMFHHC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-but-2-ynyldodeca-5,6-dien-1,9-diyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-but-2-ynyldodeca-5,6-dien-1,9-diyne?
The IUPAC name of 5-but-2-ynyldodeca-5,6-dien-1,9-diyne (CID 57210444) is 5-but-2-ynyldodeca-5,6-dien-1,9-diyne.
What is the SMILES notation for 5-but-2-ynyldodeca-5,6-dien-1,9-diyne?
The canonical SMILES for 5-but-2-ynyldodeca-5,6-dien-1,9-diyne is C#CCCC(=C=CCC#CCC)CC#CC.
What is the InChIKey of 5-but-2-ynyldodeca-5,6-dien-1,9-diyne?
The InChIKey is HBWVSVGNEMFHHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18/c1-4-7-10-11-12-15-16(13-8-5-2)14-9-6-3/h2,12H,4,8,11,13-14H2,1,3H3.
What are the key properties of 5-but-2-ynyldodeca-5,6-dien-1,9-diyne?
5-but-2-ynyldodeca-5,6-dien-1,9-diyne has a molecular weight of 210.32 g/mol, XLogP of 3.70, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-but-2-ynyldodeca-5,6-dien-1,9-diyne is sourced from PubChem (CID 57210444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).