About 1-(3-methyl-1,2,4-triazol-1-yl)ethanol
1-(3-methyl-1,2,4-triazol-1-yl)ethanol (PubChem CID 57210631) has the molecular formula C5H9N3O
and a molecular weight of 127.15 g/mol. Its IUPAC name is 1-(3-methyl-1,2,4-triazol-1-yl)ethanol.
Molecular Properties
| Compound Name | 1-(3-methyl-1,2,4-triazol-1-yl)ethanol |
| PubChem CID | 57210631 |
| Molecular Formula | C5H9N3O |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.07 |
| IUPAC Name | 1-(3-methyl-1,2,4-triazol-1-yl)ethanol |
| SMILES | Cc1ncn(C(C)O)n1 |
| InChI | InChI=1S/C5H9N3O/c1-4-6-3-8(7-4)5(2)9/h3,5,9H,1-2H3 |
| InChIKey | MVYJLINOYDVOEH-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-methyl-1,2,4-triazol-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methyl-1,2,4-triazol-1-yl)ethanol?
The IUPAC name of 1-(3-methyl-1,2,4-triazol-1-yl)ethanol (CID 57210631) is 1-(3-methyl-1,2,4-triazol-1-yl)ethanol.
What is the SMILES notation for 1-(3-methyl-1,2,4-triazol-1-yl)ethanol?
The canonical SMILES for 1-(3-methyl-1,2,4-triazol-1-yl)ethanol is Cc1ncn(C(C)O)n1.
What is the InChIKey of 1-(3-methyl-1,2,4-triazol-1-yl)ethanol?
The InChIKey is MVYJLINOYDVOEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O/c1-4-6-3-8(7-4)5(2)9/h3,5,9H,1-2H3.
What are the key properties of 1-(3-methyl-1,2,4-triazol-1-yl)ethanol?
1-(3-methyl-1,2,4-triazol-1-yl)ethanol has a molecular weight of 127.15 g/mol, XLogP of 0.10, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methyl-1,2,4-triazol-1-yl)ethanol is sourced from PubChem (CID 57210631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).