About dimethyl-(3,3,3-trifluoropropyl)-[2-(2-trimethylsilyloxan-2-yl)oxan-2-yl]silane
dimethyl-(3,3,3-trifluoropropyl)-[2-(2-trimethylsilyloxan-2-yl)oxan-2-yl]silane (PubChem CID 57210663) has the molecular formula C18H35F3O2Si2
and a molecular weight of 396.64 g/mol. Its IUPAC name is dimethyl-(3,3,3-trifluoropropyl)-[2-(2-trimethylsilyloxan-2-yl)oxan-2-yl]silane.
Molecular Properties
| Compound Name | dimethyl-(3,3,3-trifluoropropyl)-[2-(2-trimethylsilyloxan-2-yl)oxan-2-yl]silane |
| PubChem CID | 57210663 |
| Molecular Formula | C18H35F3O2Si2 |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | dimethyl-(3,3,3-trifluoropropyl)-[2-(2-trimethylsilyloxan-2-yl)oxan-2-yl]silane |
| SMILES | C[Si](C)(C)C1(C2([Si](C)(C)CCC(F)(F)F)CCCCO2)CCCCO1 |
| InChI | InChI=1S/C18H35F3O2Si2/c1-24(2,3)16(10-6-8-13-22-16)17(11-7-9-14-23-17)25(4,5)15-12-18(19,20)21/h6-15H2,1-5H3 |
| InChIKey | MTDMEMLVNYQCJG-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-(3,3,3-trifluoropropyl)-[2-(2-trimethylsilyloxan-2-yl)oxan-2-yl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-(3,3,3-trifluoropropyl)-[2-(2-trimethylsilyloxan-2-yl)oxan-2-yl]silane?
The IUPAC name of dimethyl-(3,3,3-trifluoropropyl)-[2-(2-trimethylsilyloxan-2-yl)oxan-2-yl]silane (CID 57210663) is dimethyl-(3,3,3-trifluoropropyl)-[2-(2-trimethylsilyloxan-2-yl)oxan-2-yl]silane.
What is the SMILES notation for dimethyl-(3,3,3-trifluoropropyl)-[2-(2-trimethylsilyloxan-2-yl)oxan-2-yl]silane?
The canonical SMILES for dimethyl-(3,3,3-trifluoropropyl)-[2-(2-trimethylsilyloxan-2-yl)oxan-2-yl]silane is C[Si](C)(C)C1(C2([Si](C)(C)CCC(F)(F)F)CCCCO2)CCCCO1.
What is the InChIKey of dimethyl-(3,3,3-trifluoropropyl)-[2-(2-trimethylsilyloxan-2-yl)oxan-2-yl]silane?
The InChIKey is MTDMEMLVNYQCJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35F3O2Si2/c1-24(2,3)16(10-6-8-13-22-16)17(11-7-9-14-23-17)25(4,5)15-12-18(19,20)21/h6-15H2,1-5H3.
What are the key properties of dimethyl-(3,3,3-trifluoropropyl)-[2-(2-trimethylsilyloxan-2-yl)oxan-2-yl]silane?
dimethyl-(3,3,3-trifluoropropyl)-[2-(2-trimethylsilyloxan-2-yl)oxan-2-yl]silane has a molecular weight of 396.64 g/mol, XLogP of 5.94, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-(3,3,3-trifluoropropyl)-[2-(2-trimethylsilyloxan-2-yl)oxan-2-yl]silane is sourced from PubChem (CID 57210663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).