About 2-(3-methylbuta-1,3-dienoxymethyl)oxirane
2-(3-methylbuta-1,3-dienoxymethyl)oxirane (PubChem CID 57211047) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is 2-(3-methylbuta-1,3-dienoxymethyl)oxirane.
Molecular Properties
| Compound Name | 2-(3-methylbuta-1,3-dienoxymethyl)oxirane |
| PubChem CID | 57211047 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 2-(3-methylbuta-1,3-dienoxymethyl)oxirane |
| SMILES | C=C(C)C=COCC1CO1 |
| InChI | InChI=1S/C8H12O2/c1-7(2)3-4-9-5-8-6-10-8/h3-4,8H,1,5-6H2,2H3 |
| InChIKey | FKRNUDHBTGMGMQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methylbuta-1,3-dienoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylbuta-1,3-dienoxymethyl)oxirane?
The IUPAC name of 2-(3-methylbuta-1,3-dienoxymethyl)oxirane (CID 57211047) is 2-(3-methylbuta-1,3-dienoxymethyl)oxirane.
What is the SMILES notation for 2-(3-methylbuta-1,3-dienoxymethyl)oxirane?
The canonical SMILES for 2-(3-methylbuta-1,3-dienoxymethyl)oxirane is C=C(C)C=COCC1CO1.
What is the InChIKey of 2-(3-methylbuta-1,3-dienoxymethyl)oxirane?
The InChIKey is FKRNUDHBTGMGMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2/c1-7(2)3-4-9-5-8-6-10-8/h3-4,8H,1,5-6H2,2H3.
What are the key properties of 2-(3-methylbuta-1,3-dienoxymethyl)oxirane?
2-(3-methylbuta-1,3-dienoxymethyl)oxirane has a molecular weight of 140.18 g/mol, XLogP of 1.49, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylbuta-1,3-dienoxymethyl)oxirane is sourced from PubChem (CID 57211047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).