About 3-[(1S)-2,2-bis(4-fluorophenyl)cyclopropyl]-N-(4-pyridazin-3-ylbutyl)prop-2-enamide
3-[(1S)-2,2-bis(4-fluorophenyl)cyclopropyl]-N-(4-pyridazin-3-ylbutyl)prop-2-enamide (PubChem CID 57211146) has the molecular formula C26H25F2N3O
and a molecular weight of 433.50 g/mol. Its IUPAC name is 3-[(1S)-2,2-bis(4-fluorophenyl)cyclopropyl]-N-(4-pyridazin-3-ylbutyl)prop-2-enamide.
Molecular Properties
| Compound Name | 3-[(1S)-2,2-bis(4-fluorophenyl)cyclopropyl]-N-(4-pyridazin-3-ylbutyl)prop-2-enamide |
| PubChem CID | 57211146 |
| Molecular Formula | C26H25F2N3O |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 3-[(1S)-2,2-bis(4-fluorophenyl)cyclopropyl]-N-(4-pyridazin-3-ylbutyl)prop-2-enamide |
| SMILES | O=C(C=C[C@@H]1CC1(c1ccc(F)cc1)c1ccc(F)cc1)NCCCCc1cccnn1 |
| InChI | InChI=1S/C26H25F2N3O/c27-22-11-6-19(7-12-22)26(20-8-13-23(28)14-9-20)18-21(26)10-15-25(32)29-16-2-1-4-24-5-3-17-30-31-24/h3,5-15,17,21H,1-2,4,16,18H2,(H,29,32)/t21-/m1/s1 |
| InChIKey | FXVJMRWYAMNAJI-OAQYLSRUSA-N |
| XLogP | 4.76 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1S)-2,2-bis(4-fluorophenyl)cyclopropyl]-N-(4-pyridazin-3-ylbutyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1S)-2,2-bis(4-fluorophenyl)cyclopropyl]-N-(4-pyridazin-3-ylbutyl)prop-2-enamide?
The IUPAC name of 3-[(1S)-2,2-bis(4-fluorophenyl)cyclopropyl]-N-(4-pyridazin-3-ylbutyl)prop-2-enamide (CID 57211146) is 3-[(1S)-2,2-bis(4-fluorophenyl)cyclopropyl]-N-(4-pyridazin-3-ylbutyl)prop-2-enamide.
What is the SMILES notation for 3-[(1S)-2,2-bis(4-fluorophenyl)cyclopropyl]-N-(4-pyridazin-3-ylbutyl)prop-2-enamide?
The canonical SMILES for 3-[(1S)-2,2-bis(4-fluorophenyl)cyclopropyl]-N-(4-pyridazin-3-ylbutyl)prop-2-enamide is O=C(C=C[C@@H]1CC1(c1ccc(F)cc1)c1ccc(F)cc1)NCCCCc1cccnn1.
What is the InChIKey of 3-[(1S)-2,2-bis(4-fluorophenyl)cyclopropyl]-N-(4-pyridazin-3-ylbutyl)prop-2-enamide?
The InChIKey is FXVJMRWYAMNAJI-OAQYLSRUSA-N. The full InChI is InChI=1S/C26H25F2N3O/c27-22-11-6-19(7-12-22)26(20-8-13-23(28)14-9-20)18-21(26)10-15-25(32)29-16-2-1-4-24-5-3-17-30-31-24/h3,5-15,17,21H,1-2,4,16,18H2,(H,29,32)/t21-/m1/s1.
What are the key properties of 3-[(1S)-2,2-bis(4-fluorophenyl)cyclopropyl]-N-(4-pyridazin-3-ylbutyl)prop-2-enamide?
3-[(1S)-2,2-bis(4-fluorophenyl)cyclopropyl]-N-(4-pyridazin-3-ylbutyl)prop-2-enamide has a molecular weight of 433.50 g/mol, XLogP of 4.76, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1S)-2,2-bis(4-fluorophenyl)cyclopropyl]-N-(4-pyridazin-3-ylbutyl)prop-2-enamide is sourced from PubChem (CID 57211146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).