C9H10F4 — CID 57211864
1-(1,1,2,2-tetrafluorobutyl)cyclopenta-1,3-diene (PubChem CID 57211864) has the molecular formula C9H10F4 and a molecular weight of 194.17 g/mol. Its IUPAC name is 1-(1,1,2,2-tetrafluorobutyl)cyclopenta-1,3-diene.
| Compound Name | 1-(1,1,2,2-tetrafluorobutyl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 57211864 |
| Molecular Formula | C9H10F4 |
| Molecular Weight | 194.17 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 1-(1,1,2,2-tetrafluorobutyl)cyclopenta-1,3-diene |
| SMILES | CCC(F)(F)C(F)(F)C1=CC=CC1 |
| InChI | InChI=1S/C9H10F4/c1-2-8(10,11)9(12,13)7-5-3-4-6-7/h3-5H,2,6H2,1H3 |
| InChIKey | DLJCNCWKMOXPLR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.17 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|