C10H2F16O — CID 57212045
1,1,1,2,3,5,5,5-octafluoro-4-(1,1,1,3,4,5,5,5-octafluoropent-3-en-2-yloxy)pent-2-ene (PubChem CID 57212045) has the molecular formula C10H2F16O and a molecular weight of 442.09 g/mol. Its IUPAC name is 1,1,1,2,3,5,5,5-octafluoro-4-(1,1,1,3,4,5,5,5-octafluoropent-3-en-2-yloxy)pent-2-ene.
| Compound Name | 1,1,1,2,3,5,5,5-octafluoro-4-(1,1,1,3,4,5,5,5-octafluoropent-3-en-2-yloxy)pent-2-ene |
|---|---|
| PubChem CID | 57212045 |
| Molecular Formula | C10H2F16O |
| Molecular Weight | 442.09 g/mol |
| Exact Mass | 441.99 |
| IUPAC Name | 1,1,1,2,3,5,5,5-octafluoro-4-(1,1,1,3,4,5,5,5-octafluoropent-3-en-2-yloxy)pent-2-ene |
| SMILES | FC(=C(F)C(F)(F)F)C(OC(C(F)=C(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H2F16O/c11-1(3(13)7(15,16)17)5(9(21,22)23)27-6(10(24,25)26)2(12)4(14)8(18,19)20/h5-6H |
| InChIKey | WEHHAUIOVASKQX-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.09 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |