C10H14Cl2N4 — CID 57212261
4,6-dichloro-5-methyl-2-(2-methylpiperazin-1-yl)pyrimidine (PubChem CID 57212261) has the molecular formula C10H14Cl2N4 and a molecular weight of 261.16 g/mol. Its IUPAC name is 4,6-dichloro-5-methyl-2-(2-methylpiperazin-1-yl)pyrimidine.
| Compound Name | 4,6-dichloro-5-methyl-2-(2-methylpiperazin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 57212261 |
| Molecular Formula | C10H14Cl2N4 |
| Molecular Weight | 261.16 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 4,6-dichloro-5-methyl-2-(2-methylpiperazin-1-yl)pyrimidine |
| SMILES | Cc1c(Cl)nc(N2CCNCC2C)nc1Cl |
| InChI | InChI=1S/C10H14Cl2N4/c1-6-5-13-3-4-16(6)10-14-8(11)7(2)9(12)15-10/h6,13H,3-5H2,1-2H3 |
| InChIKey | XUOVINPKTIOGEE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.16 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |